C14H24O — CID 155254907
4-[(1S,3S,6R)-2,2,3,6-tetramethylcyclohexyl]but-3-en-2-one (PubChem CID 155254907) has the molecular formula C14H24O and a molecular weight of 208.34 g/mol. Its IUPAC name is 4-[(1S,3S,6R)-2,2,3,6-tetramethylcyclohexyl]but-3-en-2-one.
| Compound Name | 4-[(1S,3S,6R)-2,2,3,6-tetramethylcyclohexyl]but-3-en-2-one |
|---|---|
| PubChem CID | 155254907 |
| Molecular Formula | C14H24O |
| Molecular Weight | 208.34 g/mol |
| Exact Mass | 208.18 |
| IUPAC Name | 4-[(1S,3S,6R)-2,2,3,6-tetramethylcyclohexyl]but-3-en-2-one |
| SMILES | CC(=O)C=C[C@@H]1[C@H](C)CC[C@H](C)C1(C)C |
| InChI | InChI=1S/C14H24O/c1-10-6-7-11(2)14(4,5)13(10)9-8-12(3)15/h8-11,13H,6-7H2,1-5H3/t10-,11+,13-/m1/s1 |
| InChIKey | ZNWOKRUGFTXKDK-NTZNESFSSA-N |
| XLogP | 3.84 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.34 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|