C11H21F2N — CID 105146065
1-(4,4-difluorocyclohexyl)-2,2-dimethylpropan-1-amine (PubChem CID 105146065) has the molecular formula C11H21F2N and a molecular weight of 205.29 g/mol. Its IUPAC name is 1-(4,4-difluorocyclohexyl)-2,2-dimethylpropan-1-amine.
| Compound Name | 1-(4,4-difluorocyclohexyl)-2,2-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 105146065 |
| Molecular Formula | C11H21F2N |
| Molecular Weight | 205.29 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | 1-(4,4-difluorocyclohexyl)-2,2-dimethylpropan-1-amine |
| SMILES | CC(C)(C)C(N)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C11H21F2N/c1-10(2,3)9(14)8-4-6-11(12,13)7-5-8/h8-9H,4-7,14H2,1-3H3 |
| InChIKey | BFHYCOMVQUITNB-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.29 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |