C18H21ClF2N6O — CID 142546851
4-[5-amino-4-[amino-[1-[2-(difluoromethyl)phenyl]ethyl]amino]-3,6-dihydro-2H-pyridin-1-yl]-5-chloro-1H-pyridazin-6-one (PubChem CID 142546851) has the molecular formula C18H21ClF2N6O and a molecular weight of 410.86 g/mol. Its IUPAC name is 4-[5-amino-4-[amino-[1-[2-(difluoromethyl)phenyl]ethyl]amino]-3,6-dihydro-2H-pyridin-1-yl]-5-chloro-1H-pyridazin-6-one.
| Compound Name | 4-[5-amino-4-[amino-[1-[2-(difluoromethyl)phenyl]ethyl]amino]-3,6-dihydro-2H-pyridin-1-yl]-5-chloro-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 142546851 |
| Molecular Formula | C18H21ClF2N6O |
| Molecular Weight | 410.86 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | 4-[5-amino-4-[amino-[1-[2-(difluoromethyl)phenyl]ethyl]amino]-3,6-dihydro-2H-pyridin-1-yl]-5-chloro-1H-pyridazin-6-one |
| SMILES | CC(c1ccccc1C(F)F)N(N)C1=C(N)CN(c2cn[nH]c(=O)c2Cl)CC1 |
| InChI | InChI=1S/C18H21ClF2N6O/c1-10(11-4-2-3-5-12(11)17(20)21)27(23)14-6-7-26(9-13(14)22)15-8-24-25-18(28)16(15)19/h2-5,8,10,17H,6-7,9,22-23H2,1H3,(H,25,28) |
| InChIKey | HPFQXYAPYIBOMV-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 104.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.86 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|