C21H27ClFN7O2 — CID 138483970
4-[5-amino-4-[amino-[[4-fluoro-2-(morpholin-4-ylmethyl)phenyl]methyl]amino]-3,6-dihydro-2H-pyridin-1-yl]-5-chloro-1H-pyridazin-6-one (PubChem CID 138483970) has the molecular formula C21H27ClFN7O2 and a molecular weight of 463.95 g/mol. Its IUPAC name is 4-[5-amino-4-[amino-[[4-fluoro-2-(morpholin-4-ylmethyl)phenyl]methyl]amino]-3,6-dihydro-2H-pyridin-1-yl]-5-chloro-1H-pyridazin-6-one.
| Compound Name | 4-[5-amino-4-[amino-[[4-fluoro-2-(morpholin-4-ylmethyl)phenyl]methyl]amino]-3,6-dihydro-2H-pyridin-1-yl]-5-chloro-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 138483970 |
| Molecular Formula | C21H27ClFN7O2 |
| Molecular Weight | 463.95 g/mol |
| Exact Mass | 463.19 |
| IUPAC Name | 4-[5-amino-4-[amino-[[4-fluoro-2-(morpholin-4-ylmethyl)phenyl]methyl]amino]-3,6-dihydro-2H-pyridin-1-yl]-5-chloro-1H-pyridazin-6-one |
| SMILES | NC1=C(N(N)Cc2ccc(F)cc2CN2CCOCC2)CCN(c2cn[nH]c(=O)c2Cl)C1 |
| InChI | InChI=1S/C21H27ClFN7O2/c22-20-19(10-26-27-21(20)31)29-4-3-18(17(24)13-29)30(25)12-14-1-2-16(23)9-15(14)11-28-5-7-32-8-6-28/h1-2,9-10H,3-8,11-13,24-25H2,(H,27,31) |
| InChIKey | KXOSTOSUGHPWAN-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 116.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.95 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|