C18H19ClF4N6O — CID 142546868
4-[5-amino-4-[amino-[[4-fluoro-2-(2,2,2-trifluoroethyl)phenyl]methyl]amino]-3,6-dihydro-2H-pyridin-1-yl]-5-chloro-1H-pyridazin-6-one (PubChem CID 142546868) has the molecular formula C18H19ClF4N6O and a molecular weight of 446.84 g/mol. Its IUPAC name is 4-[5-amino-4-[amino-[[4-fluoro-2-(2,2,2-trifluoroethyl)phenyl]methyl]amino]-3,6-dihydro-2H-pyridin-1-yl]-5-chloro-1H-pyridazin-6-one.
| Compound Name | 4-[5-amino-4-[amino-[[4-fluoro-2-(2,2,2-trifluoroethyl)phenyl]methyl]amino]-3,6-dihydro-2H-pyridin-1-yl]-5-chloro-1H-pyridazin-6-one |
|---|---|
| PubChem CID | 142546868 |
| Molecular Formula | C18H19ClF4N6O |
| Molecular Weight | 446.84 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | 4-[5-amino-4-[amino-[[4-fluoro-2-(2,2,2-trifluoroethyl)phenyl]methyl]amino]-3,6-dihydro-2H-pyridin-1-yl]-5-chloro-1H-pyridazin-6-one |
| SMILES | NC1=C(N(N)Cc2ccc(F)cc2CC(F)(F)F)CCN(c2cn[nH]c(=O)c2Cl)C1 |
| InChI | InChI=1S/C18H19ClF4N6O/c19-16-15(7-26-27-17(16)30)28-4-3-14(13(24)9-28)29(25)8-10-1-2-12(20)5-11(10)6-18(21,22)23/h1-2,5,7H,3-4,6,8-9,24-25H2,(H,27,30) |
| InChIKey | LBGXGPWHEWORKP-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 104.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.84 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|