C11H22N5O2+ — CID 142547128
tert-butyl 6-amino-1-(N'-methylcarbamimidoyl)-3,5-dihydro-2H-pyrazin-1-ium-4-carboxylate (PubChem CID 142547128) has the molecular formula C11H22N5O2+ and a molecular weight of 256.33 g/mol. Its IUPAC name is tert-butyl 6-amino-1-(N'-methylcarbamimidoyl)-3,5-dihydro-2H-pyrazin-1-ium-4-carboxylate.
| Compound Name | tert-butyl 6-amino-1-(N'-methylcarbamimidoyl)-3,5-dihydro-2H-pyrazin-1-ium-4-carboxylate |
|---|---|
| PubChem CID | 142547128 |
| Molecular Formula | C11H22N5O2+ |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | tert-butyl 6-amino-1-(N'-methylcarbamimidoyl)-3,5-dihydro-2H-pyrazin-1-ium-4-carboxylate |
| SMILES | C/N=C(\N)[N+]1=C(N)CN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C11H21N5O2/c1-11(2,3)18-10(17)15-5-6-16(8(12)7-15)9(13)14-4/h12H,5-7H2,1-4H3,(H2,13,14)/p+1 |
| InChIKey | HZYKPSYCBQYTND-UHFFFAOYSA-O |
| XLogP | -0.45 |
| TPSA | 96.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|