C17H26N6O2 — CID 142548626
acetylene;4-amino-7-[3-(aminomethyl)cyclopentyl]-2-methylpyrrolo[2,3-d]pyrimidine-5-carboxamide;methanol (PubChem CID 142548626) has the molecular formula C17H26N6O2 and a molecular weight of 346.44 g/mol. Its IUPAC name is acetylene;4-amino-7-[3-(aminomethyl)cyclopentyl]-2-methylpyrrolo[2,3-d]pyrimidine-5-carboxamide;methanol.
| Compound Name | acetylene;4-amino-7-[3-(aminomethyl)cyclopentyl]-2-methylpyrrolo[2,3-d]pyrimidine-5-carboxamide;methanol |
|---|---|
| PubChem CID | 142548626 |
| Molecular Formula | C17H26N6O2 |
| Molecular Weight | 346.44 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | acetylene;4-amino-7-[3-(aminomethyl)cyclopentyl]-2-methylpyrrolo[2,3-d]pyrimidine-5-carboxamide;methanol |
| SMILES | C#C.CO.Cc1nc(N)c2c(C(N)=O)cn(C3CCC(CN)C3)c2n1 |
| InChI | InChI=1S/C14H20N6O.C2H2.CH4O/c1-7-18-12(16)11-10(13(17)21)6-20(14(11)19-7)9-3-2-8(4-9)5-15;2*1-2/h6,8-9H,2-5,15H2,1H3,(H2,17,21)(H2,16,18,19);1-2H;2H,1H3 |
| InChIKey | QQMVBAXAHCNYHL-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 146.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.44 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|