C11H19N — CID 142548961
ethane;3,4,5,6,7,8-hexahydroquinoline (PubChem CID 142548961) has the molecular formula C11H19N and a molecular weight of 165.28 g/mol. Its IUPAC name is ethane;3,4,5,6,7,8-hexahydroquinoline.
| Compound Name | ethane;3,4,5,6,7,8-hexahydroquinoline |
|---|---|
| PubChem CID | 142548961 |
| Molecular Formula | C11H19N |
| Molecular Weight | 165.28 g/mol |
| Exact Mass | 165.15 |
| IUPAC Name | ethane;3,4,5,6,7,8-hexahydroquinoline |
| SMILES | C1=NC2=C(CC1)CCCC2.CC |
| InChI | InChI=1S/C9H13N.C2H6/c1-2-6-9-8(4-1)5-3-7-10-9;1-2/h7H,1-6H2;1-2H3 |
| InChIKey | IVUBMGZHJTZDON-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.28 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |