C16H10Cl2FN2O- — CID 142555231
5,7-dichloro-2-[(4-fluoroanilino)methyl]quinolin-8-olate (PubChem CID 142555231) has the molecular formula C16H10Cl2FN2O- and a molecular weight of 336.17 g/mol. Its IUPAC name is 5,7-dichloro-2-[(4-fluoroanilino)methyl]quinolin-8-olate.
| Compound Name | 5,7-dichloro-2-[(4-fluoroanilino)methyl]quinolin-8-olate |
|---|---|
| PubChem CID | 142555231 |
| Molecular Formula | C16H10Cl2FN2O- |
| Molecular Weight | 336.17 g/mol |
| Exact Mass | 335.02 |
| IUPAC Name | 5,7-dichloro-2-[(4-fluoroanilino)methyl]quinolin-8-olate |
| SMILES | [O-]c1c(Cl)cc(Cl)c2ccc(CNc3ccc(F)cc3)nc12 |
| InChI | InChI=1S/C16H11Cl2FN2O/c17-13-7-14(18)16(22)15-12(13)6-5-11(21-15)8-20-10-3-1-9(19)2-4-10/h1-7,20,22H,8H2/p-1 |
| InChIKey | YQFDREKOZDQHBL-UHFFFAOYSA-M |
| XLogP | 4.37 |
| TPSA | 47.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.17 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |