C13H25N — CID 142560281
1-cyclohexyl-2,2,3-trimethylbutan-1-imine (PubChem CID 142560281) has the molecular formula C13H25N and a molecular weight of 195.35 g/mol. Its IUPAC name is 1-cyclohexyl-2,2,3-trimethylbutan-1-imine.
| Compound Name | 1-cyclohexyl-2,2,3-trimethylbutan-1-imine |
|---|---|
| PubChem CID | 142560281 |
| Molecular Formula | C13H25N |
| Molecular Weight | 195.35 g/mol |
| Exact Mass | 195.20 |
| IUPAC Name | 1-cyclohexyl-2,2,3-trimethylbutan-1-imine |
| SMILES | [H]/N=C(\C1CCCCC1)C(C)(C)C(C)C |
| InChI | InChI=1S/C13H25N/c1-10(2)13(3,4)12(14)11-8-6-5-7-9-11/h10-11,14H,5-9H2,1-4H3/b14-12+ |
| InChIKey | XZVZRAYOZFUIKX-WYMLVPIESA-N |
| XLogP | 4.27 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.35 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|