C18H20S — CID 142560896
7-methyl-1,2-dihydrodibenzothiophene;(3Z)-penta-1,3-diene (PubChem CID 142560896) has the molecular formula C18H20S and a molecular weight of 268.43 g/mol. Its IUPAC name is 7-methyl-1,2-dihydrodibenzothiophene;(3Z)-penta-1,3-diene.
| Compound Name | 7-methyl-1,2-dihydrodibenzothiophene;(3Z)-penta-1,3-diene |
|---|---|
| PubChem CID | 142560896 |
| Molecular Formula | C18H20S |
| Molecular Weight | 268.43 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 7-methyl-1,2-dihydrodibenzothiophene;(3Z)-penta-1,3-diene |
| SMILES | C=C/C=C\C.Cc1ccc2c3c(sc2c1)C=CCC3 |
| InChI | InChI=1S/C13H12S.C5H8/c1-9-6-7-11-10-4-2-3-5-12(10)14-13(11)8-9;1-3-5-4-2/h3,5-8H,2,4H2,1H3;3-5H,1H2,2H3/b;5-4- |
| InChIKey | QMDYSBOHABLXRL-GUHKXDMSSA-N |
| XLogP | 5.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.43 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|