C37H30N2S — CID 88905771
1-[3-(8,9-dihydrodibenzothiophen-4-yl)phenyl]-N-[2,7-dimethyl-10-(methylideneamino)phenanthren-9-yl]ethanimine (PubChem CID 88905771) has the molecular formula C37H30N2S and a molecular weight of 534.73 g/mol. Its IUPAC name is 1-[3-(8,9-dihydrodibenzothiophen-4-yl)phenyl]-N-[2,7-dimethyl-10-(methylideneamino)phenanthren-9-yl]ethanimine.
| Compound Name | 1-[3-(8,9-dihydrodibenzothiophen-4-yl)phenyl]-N-[2,7-dimethyl-10-(methylideneamino)phenanthren-9-yl]ethanimine |
|---|---|
| PubChem CID | 88905771 |
| Molecular Formula | C37H30N2S |
| Molecular Weight | 534.73 g/mol |
| Exact Mass | 534.21 |
| IUPAC Name | 1-[3-(8,9-dihydrodibenzothiophen-4-yl)phenyl]-N-[2,7-dimethyl-10-(methylideneamino)phenanthren-9-yl]ethanimine |
| SMILES | C=Nc1c(/N=C(\C)c2cccc(-c3cccc4c5c(sc34)C=CCC5)c2)c2cc(C)ccc2c2ccc(C)cc12 |
| InChI | InChI=1S/C37H30N2S/c1-22-15-17-28-29-18-16-23(2)20-33(29)36(35(38-4)32(28)19-22)39-24(3)25-9-7-10-26(21-25)27-12-8-13-31-30-11-5-6-14-34(30)40-37(27)31/h6-10,12-21H,4-5,11H2,1-3H3/b39-24+ |
| InChIKey | YAXJNGTZBLOSPY-HZQMBONKSA-N |
| XLogP | 10.92 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.73 |
| LogP ≤ 5 | 10.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|