C51H46N4O2 — CID 142560931
(2Z)-1-[3-[4-[3-(8,8-dimethyl-11,12-dihydroindeno[1,2-a]oxanthren-1-yl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]penta-2,4-dien-1-imine;ethane;ethene (PubChem CID 142560931) has the molecular formula C51H46N4O2 and a molecular weight of 746.96 g/mol. Its IUPAC name is (2Z)-1-[3-[4-[3-(8,8-dimethyl-11,12-dihydroindeno[1,2-a]oxanthren-1-yl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]penta-2,4-dien-1-imine;ethane;ethene.
| Compound Name | (2Z)-1-[3-[4-[3-(8,8-dimethyl-11,12-dihydroindeno[1,2-a]oxanthren-1-yl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]penta-2,4-dien-1-imine;ethane;ethene |
|---|---|
| PubChem CID | 142560931 |
| Molecular Formula | C51H46N4O2 |
| Molecular Weight | 746.96 g/mol |
| Exact Mass | 746.36 |
| IUPAC Name | (2Z)-1-[3-[4-[3-(8,8-dimethyl-11,12-dihydroindeno[1,2-a]oxanthren-1-yl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]phenyl]penta-2,4-dien-1-imine;ethane;ethene |
| SMILES | C=C.CC.[H]/N=C(\C=C/C=C)c1cccc(-c2nc(-c3ccccc3)nc(-c3cccc(-c4cccc5c4Oc4c(ccc6c4C4=C(C=CCC4)C6(C)C)O5)c3)n2)c1 |
| InChI | InChI=1S/C47H36N4O2.C2H6.C2H4/c1-4-5-23-38(48)31-17-12-19-33(28-31)46-50-44(29-14-7-6-8-15-29)49-45(51-46)32-18-11-16-30(27-32)34-21-13-24-39-42(34)53-43-40(52-39)26-25-37-41(43)35-20-9-10-22-36(35)47(37,2)3;2*1-2/h4-8,10-19,21-28,48H,1,9,20H2,2-3H3;1-2H3;1-2H2/b23-5-,48-38+;; |
| InChIKey | PMVFXMPGQHEYOK-MRYBDEMCSA-N |
| XLogP | 13.77 |
| TPSA | 80.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.96 |
| LogP ≤ 5 | 13.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|