C14H23N4O2+ — CID 142562030
6-ethoxy-5-[4-(oxetan-3-yl)piperazin-1-yl]pyridin-1-ium-2-amine (PubChem CID 142562030) has the molecular formula C14H23N4O2+ and a molecular weight of 279.36 g/mol. Its IUPAC name is 6-ethoxy-5-[4-(oxetan-3-yl)piperazin-1-yl]pyridin-1-ium-2-amine.
| Compound Name | 6-ethoxy-5-[4-(oxetan-3-yl)piperazin-1-yl]pyridin-1-ium-2-amine |
|---|---|
| PubChem CID | 142562030 |
| Molecular Formula | C14H23N4O2+ |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | 6-ethoxy-5-[4-(oxetan-3-yl)piperazin-1-yl]pyridin-1-ium-2-amine |
| SMILES | CCOc1[nH+]c(N)ccc1N1CCN(C2COC2)CC1 |
| InChI | InChI=1S/C14H22N4O2/c1-2-20-14-12(3-4-13(15)16-14)18-7-5-17(6-8-18)11-9-19-10-11/h3-4,11H,2,5-10H2,1H3,(H2,15,16)/p+1 |
| InChIKey | LBAHYWOEFYICCN-UHFFFAOYSA-O |
| XLogP | 0.00 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |