C20H26N8O2 — CID 142562032
(1E)-1-[2-[(E)-1-cyanoprop-1-enyl]iminoethylidene]-2-[6-methoxy-5-[4-(oxetan-3-yl)piperazin-1-yl]-2-pyridinyl]guanidine (PubChem CID 142562032) has the molecular formula C20H26N8O2 and a molecular weight of 410.48 g/mol. Its IUPAC name is (1E)-1-[2-[(E)-1-cyanoprop-1-enyl]iminoethylidene]-2-[6-methoxy-5-[4-(oxetan-3-yl)piperazin-1-yl]-2-pyridinyl]guanidine.
| Compound Name | (1E)-1-[2-[(E)-1-cyanoprop-1-enyl]iminoethylidene]-2-[6-methoxy-5-[4-(oxetan-3-yl)piperazin-1-yl]-2-pyridinyl]guanidine |
|---|---|
| PubChem CID | 142562032 |
| Molecular Formula | C20H26N8O2 |
| Molecular Weight | 410.48 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | (1E)-1-[2-[(E)-1-cyanoprop-1-enyl]iminoethylidene]-2-[6-methoxy-5-[4-(oxetan-3-yl)piperazin-1-yl]-2-pyridinyl]guanidine |
| SMILES | C/C=C(C#N)/N=C/C=N/C(N)=N/c1ccc(N2CCN(C3COC3)CC2)c(OC)n1 |
| InChI | InChI=1S/C20H26N8O2/c1-3-15(12-21)23-6-7-24-20(22)26-18-5-4-17(19(25-18)29-2)28-10-8-27(9-11-28)16-13-30-14-16/h3-7,16H,8-11,13-14H2,1-2H3,(H2,22,25,26)/b15-3+,23-6+,24-7+ |
| InChIKey | GYBDFFULZIUIFS-UXEAFJGBSA-N |
| XLogP | 1.13 |
| TPSA | 124.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.48 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|