C19H29N5O — CID 142561903
(1E)-1-(3-methylbut-2-enylidene)-2-[4-[4-(oxetan-3-yl)piperazin-1-yl]phenyl]guanidine;molecular hydrogen (PubChem CID 142561903) has the molecular formula C19H29N5O and a molecular weight of 343.48 g/mol. Its IUPAC name is (1E)-1-(3-methylbut-2-enylidene)-2-[4-[4-(oxetan-3-yl)piperazin-1-yl]phenyl]guanidine;molecular hydrogen.
| Compound Name | (1E)-1-(3-methylbut-2-enylidene)-2-[4-[4-(oxetan-3-yl)piperazin-1-yl]phenyl]guanidine;molecular hydrogen |
|---|---|
| PubChem CID | 142561903 |
| Molecular Formula | C19H29N5O |
| Molecular Weight | 343.48 g/mol |
| Exact Mass | 343.24 |
| IUPAC Name | (1E)-1-(3-methylbut-2-enylidene)-2-[4-[4-(oxetan-3-yl)piperazin-1-yl]phenyl]guanidine;molecular hydrogen |
| SMILES | CC(C)=C/C=N/C(N)=N/c1ccc(N2CCN(C3COC3)CC2)cc1.[H][H] |
| InChI | InChI=1S/C19H27N5O.H2/c1-15(2)7-8-21-19(20)22-16-3-5-17(6-4-16)23-9-11-24(12-10-23)18-13-25-14-18;/h3-8,18H,9-14H2,1-2H3,(H2,20,22);1H/b21-8+; |
| InChIKey | NDXRSCXUSLSTJF-LQGGPMKRSA-N |
| XLogP | 2.44 |
| TPSA | 66.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.48 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|