C13H19BN2O3 — CID 175486235
[4-[(9aS)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]phenyl]boronic acid (PubChem CID 175486235) has the molecular formula C13H19BN2O3 and a molecular weight of 262.12 g/mol. Its IUPAC name is [4-[(9aS)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]phenyl]boronic acid.
| Compound Name | [4-[(9aS)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]phenyl]boronic acid |
|---|---|
| PubChem CID | 175486235 |
| Molecular Formula | C13H19BN2O3 |
| Molecular Weight | 262.12 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | [4-[(9aS)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]phenyl]boronic acid |
| SMILES | OB(O)c1ccc(N2CCN3CCOC[C@@H]3C2)cc1 |
| InChI | InChI=1S/C13H19BN2O3/c17-14(18)11-1-3-12(4-2-11)16-6-5-15-7-8-19-10-13(15)9-16/h1-4,13,17-18H,5-10H2/t13-/m0/s1 |
| InChIKey | UEWNZHHOVKMSAW-ZDUSSCGKSA-N |
| XLogP | -1.11 |
| TPSA | 56.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.12 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|