C28H36N8O2 — CID 145052816
3-cyano-4-[(3S)-3-hydroxypyrrolidin-1-yl]-N-methylidene-N'-[[4-[4-(oxetan-3-yl)piperazin-1-yl]phenyl]iminomethyl]benzenecarboximidamide;methanamine (PubChem CID 145052816) has the molecular formula C28H36N8O2 and a molecular weight of 516.65 g/mol. Its IUPAC name is 3-cyano-4-[(3S)-3-hydroxypyrrolidin-1-yl]-N-methylidene-N'-[[4-[4-(oxetan-3-yl)piperazin-1-yl]phenyl]iminomethyl]benzenecarboximidamide;methanamine.
| Compound Name | 3-cyano-4-[(3S)-3-hydroxypyrrolidin-1-yl]-N-methylidene-N'-[[4-[4-(oxetan-3-yl)piperazin-1-yl]phenyl]iminomethyl]benzenecarboximidamide;methanamine |
|---|---|
| PubChem CID | 145052816 |
| Molecular Formula | C28H36N8O2 |
| Molecular Weight | 516.65 g/mol |
| Exact Mass | 516.30 |
| IUPAC Name | 3-cyano-4-[(3S)-3-hydroxypyrrolidin-1-yl]-N-methylidene-N'-[[4-[4-(oxetan-3-yl)piperazin-1-yl]phenyl]iminomethyl]benzenecarboximidamide;methanamine |
| SMILES | C=N/C(=N\C=N\c1ccc(N2CCN(C3COC3)CC2)cc1)c1ccc(N2CC[C@H](O)C2)c(C#N)c1.CN |
| InChI | InChI=1S/C27H31N7O2.CH5N/c1-29-27(20-2-7-26(21(14-20)15-28)34-9-8-25(35)16-34)31-19-30-22-3-5-23(6-4-22)32-10-12-33(13-11-32)24-17-36-18-24;1-2/h2-7,14,19,24-25,35H,1,8-13,16-18H2;2H2,1H3/b30-19+,31-27-;/t25-;/m0./s1 |
| InChIKey | HUSGZVABVIGAQV-LUDGTIJWSA-N |
| XLogP | 2.03 |
| TPSA | 126.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.65 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|