C18H19FN2 — CID 145223823
2-(3-fluoropyrrolidin-1-yl)-5-[(3E,5Z)-hepta-1,3,5-trien-4-yl]benzonitrile (PubChem CID 145223823) has the molecular formula C18H19FN2 and a molecular weight of 282.36 g/mol. Its IUPAC name is 2-(3-fluoropyrrolidin-1-yl)-5-[(3E,5Z)-hepta-1,3,5-trien-4-yl]benzonitrile.
| Compound Name | 2-(3-fluoropyrrolidin-1-yl)-5-[(3E,5Z)-hepta-1,3,5-trien-4-yl]benzonitrile |
|---|---|
| PubChem CID | 145223823 |
| Molecular Formula | C18H19FN2 |
| Molecular Weight | 282.36 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 2-(3-fluoropyrrolidin-1-yl)-5-[(3E,5Z)-hepta-1,3,5-trien-4-yl]benzonitrile |
| SMILES | C=C/C=C(\C=C/C)c1ccc(N2CCC(F)C2)c(C#N)c1 |
| InChI | InChI=1S/C18H19FN2/c1-3-5-14(6-4-2)15-7-8-18(16(11-15)12-20)21-10-9-17(19)13-21/h3-8,11,17H,1,9-10,13H2,2H3/b6-4-,14-5+ |
| InChIKey | CUQWMDPILSYWGA-XJXGAQLSSA-N |
| XLogP | 4.25 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.36 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|