C24H32N6O — CID 142562064
(1E)-1-[(3E)-5-cyano-3,6-dimethylhepta-3,5-dien-2-ylidene]-2-[4-[4-(oxetan-3-yl)piperazin-1-yl]phenyl]guanidine (PubChem CID 142562064) has the molecular formula C24H32N6O and a molecular weight of 420.56 g/mol. Its IUPAC name is (1E)-1-[(3E)-5-cyano-3,6-dimethylhepta-3,5-dien-2-ylidene]-2-[4-[4-(oxetan-3-yl)piperazin-1-yl]phenyl]guanidine.
| Compound Name | (1E)-1-[(3E)-5-cyano-3,6-dimethylhepta-3,5-dien-2-ylidene]-2-[4-[4-(oxetan-3-yl)piperazin-1-yl]phenyl]guanidine |
|---|---|
| PubChem CID | 142562064 |
| Molecular Formula | C24H32N6O |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.26 |
| IUPAC Name | (1E)-1-[(3E)-5-cyano-3,6-dimethylhepta-3,5-dien-2-ylidene]-2-[4-[4-(oxetan-3-yl)piperazin-1-yl]phenyl]guanidine |
| SMILES | CC(C)=C(C#N)/C=C(C)/C(C)=N/C(N)=N/c1ccc(N2CCN(C3COC3)CC2)cc1 |
| InChI | InChI=1S/C24H32N6O/c1-17(2)20(14-25)13-18(3)19(4)27-24(26)28-21-5-7-22(8-6-21)29-9-11-30(12-10-29)23-15-31-16-23/h5-8,13,23H,9-12,15-16H2,1-4H3,(H2,26,28)/b18-13+,27-19+ |
| InChIKey | YMRBPAJDBVAAJQ-VSEUVJPWSA-N |
| XLogP | 3.42 |
| TPSA | 90.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|