About 6-bromo-3-methyl-1,8a-dihydroimidazo[1,2-a]pyrazin-8-amine;ethane
6-bromo-3-methyl-1,8a-dihydroimidazo[1,2-a]pyrazin-8-amine;ethane (PubChem CID 142562211) has the molecular formula C9H15BrN4
and a molecular weight of 259.15 g/mol. Its IUPAC name is 6-bromo-3-methyl-1,8a-dihydroimidazo[1,2-a]pyrazin-8-amine;ethane.
Molecular Properties
| Compound Name | 6-bromo-3-methyl-1,8a-dihydroimidazo[1,2-a]pyrazin-8-amine;ethane |
| PubChem CID | 142562211 |
| Molecular Formula | C9H15BrN4 |
| Molecular Weight | 259.15 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | 6-bromo-3-methyl-1,8a-dihydroimidazo[1,2-a]pyrazin-8-amine;ethane |
| SMILES | CC.CC1=CNC2C(N)=NC(Br)=CN12 |
| InChI | InChI=1S/C7H9BrN4.C2H6/c1-4-2-10-7-6(9)11-5(8)3-12(4)7;1-2/h2-3,7,10H,1H3,(H2,9,11);1-2H3 |
| InChIKey | JBZDWTROEQDWPE-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.15 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-3-methyl-1,8a-dihydroimidazo[1,2-a]pyrazin-8-amine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-3-methyl-1,8a-dihydroimidazo[1,2-a]pyrazin-8-amine;ethane?
The IUPAC name of 6-bromo-3-methyl-1,8a-dihydroimidazo[1,2-a]pyrazin-8-amine;ethane (CID 142562211) is 6-bromo-3-methyl-1,8a-dihydroimidazo[1,2-a]pyrazin-8-amine;ethane.
What is the SMILES notation for 6-bromo-3-methyl-1,8a-dihydroimidazo[1,2-a]pyrazin-8-amine;ethane?
The canonical SMILES for 6-bromo-3-methyl-1,8a-dihydroimidazo[1,2-a]pyrazin-8-amine;ethane is CC.CC1=CNC2C(N)=NC(Br)=CN12.
What is the InChIKey of 6-bromo-3-methyl-1,8a-dihydroimidazo[1,2-a]pyrazin-8-amine;ethane?
The InChIKey is JBZDWTROEQDWPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9BrN4.C2H6/c1-4-2-10-7-6(9)11-5(8)3-12(4)7;1-2/h2-3,7,10H,1H3,(H2,9,11);1-2H3.
What are the key properties of 6-bromo-3-methyl-1,8a-dihydroimidazo[1,2-a]pyrazin-8-amine;ethane?
6-bromo-3-methyl-1,8a-dihydroimidazo[1,2-a]pyrazin-8-amine;ethane has a molecular weight of 259.15 g/mol, XLogP of 1.67, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-3-methyl-1,8a-dihydroimidazo[1,2-a]pyrazin-8-amine;ethane is sourced from PubChem (CID 142562211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).