C18H27N — CID 142562615
4-ethyl-N-[(3E)-penta-1,3-dien-2-yl]-3-pentylaniline (PubChem CID 142562615) has the molecular formula C18H27N and a molecular weight of 257.42 g/mol. Its IUPAC name is 4-ethyl-N-[(3E)-penta-1,3-dien-2-yl]-3-pentylaniline.
| Compound Name | 4-ethyl-N-[(3E)-penta-1,3-dien-2-yl]-3-pentylaniline |
|---|---|
| PubChem CID | 142562615 |
| Molecular Formula | C18H27N |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.21 |
| IUPAC Name | 4-ethyl-N-[(3E)-penta-1,3-dien-2-yl]-3-pentylaniline |
| SMILES | C=C(/C=C/C)Nc1ccc(CC)c(CCCCC)c1 |
| InChI | InChI=1S/C18H27N/c1-5-8-9-11-17-14-18(13-12-16(17)7-3)19-15(4)10-6-2/h6,10,12-14,19H,4-5,7-9,11H2,1-3H3/b10-6+ |
| InChIKey | MRHRNCCOHFPYIL-UXBLZVDNSA-N |
| XLogP | 5.48 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|