C24H34F2N4 — CID 142563521
(3aR,5R,6aS)-N-[4-(1,3-dimethylpyrazol-4-yl)-2,3-difluorophenyl]-3a-methyl-2-(2-methylbutyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-5-amine (PubChem CID 142563521) has the molecular formula C24H34F2N4 and a molecular weight of 416.56 g/mol. Its IUPAC name is (3aR,5R,6aS)-N-[4-(1,3-dimethylpyrazol-4-yl)-2,3-difluorophenyl]-3a-methyl-2-(2-methylbutyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-5-amine.
| Compound Name | (3aR,5R,6aS)-N-[4-(1,3-dimethylpyrazol-4-yl)-2,3-difluorophenyl]-3a-methyl-2-(2-methylbutyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-5-amine |
|---|---|
| PubChem CID | 142563521 |
| Molecular Formula | C24H34F2N4 |
| Molecular Weight | 416.56 g/mol |
| Exact Mass | 416.28 |
| IUPAC Name | (3aR,5R,6aS)-N-[4-(1,3-dimethylpyrazol-4-yl)-2,3-difluorophenyl]-3a-methyl-2-(2-methylbutyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-5-amine |
| SMILES | CCC(C)CN1C[C@H]2C[C@@H](Nc3ccc(-c4cn(C)nc4C)c(F)c3F)C[C@@]2(C)C1 |
| InChI | InChI=1S/C24H34F2N4/c1-6-15(2)11-30-12-17-9-18(10-24(17,4)14-30)27-21-8-7-19(22(25)23(21)26)20-13-29(5)28-16(20)3/h7-8,13,15,17-18,27H,6,9-12,14H2,1-5H3/t15?,17-,18-,24+/m1/s1 |
| InChIKey | KXJCQIKQAAKIBZ-XXJRSEJMSA-N |
| XLogP | 5.23 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.56 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |