C16H22N2S — CID 142563549
(3aR,6aS)-5-(1-aminoethenyl)-2-benzyl-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-thiol (PubChem CID 142563549) has the molecular formula C16H22N2S and a molecular weight of 274.43 g/mol. Its IUPAC name is (3aR,6aS)-5-(1-aminoethenyl)-2-benzyl-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-thiol.
| Compound Name | (3aR,6aS)-5-(1-aminoethenyl)-2-benzyl-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-thiol |
|---|---|
| PubChem CID | 142563549 |
| Molecular Formula | C16H22N2S |
| Molecular Weight | 274.43 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | (3aR,6aS)-5-(1-aminoethenyl)-2-benzyl-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-thiol |
| SMILES | C=C(N)C1C[C@H]2CN(Cc3ccccc3)C[C@@]2(S)C1 |
| InChI | InChI=1S/C16H22N2S/c1-12(17)14-7-15-10-18(11-16(15,19)8-14)9-13-5-3-2-4-6-13/h2-6,14-15,19H,1,7-11,17H2/t14?,15-,16-/m0/s1 |
| InChIKey | DOWRZMYCCRHCMO-YVZMLIKISA-N |
| XLogP | 2.67 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.43 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|