About ethane;methane;3-methylthiane-3-carbonitrile
ethane;methane;3-methylthiane-3-carbonitrile (PubChem CID 142565790) has the molecular formula C10H21NS
and a molecular weight of 187.35 g/mol. Its IUPAC name is ethane;methane;3-methylthiane-3-carbonitrile.
Molecular Properties
| Compound Name | ethane;methane;3-methylthiane-3-carbonitrile |
| PubChem CID | 142565790 |
| Molecular Formula | C10H21NS |
| Molecular Weight | 187.35 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | ethane;methane;3-methylthiane-3-carbonitrile |
| SMILES | C.CC.CC1(C#N)CCCSC1 |
| InChI | InChI=1S/C7H11NS.C2H6.CH4/c1-7(5-8)3-2-4-9-6-7;1-2;/h2-4,6H2,1H3;1-2H3;1H4 |
| InChIKey | VCTLFVAJZSVDMB-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.35 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;methane;3-methylthiane-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methane;3-methylthiane-3-carbonitrile?
The IUPAC name of ethane;methane;3-methylthiane-3-carbonitrile (CID 142565790) is ethane;methane;3-methylthiane-3-carbonitrile.
What is the SMILES notation for ethane;methane;3-methylthiane-3-carbonitrile?
The canonical SMILES for ethane;methane;3-methylthiane-3-carbonitrile is C.CC.CC1(C#N)CCCSC1.
What is the InChIKey of ethane;methane;3-methylthiane-3-carbonitrile?
The InChIKey is VCTLFVAJZSVDMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NS.C2H6.CH4/c1-7(5-8)3-2-4-9-6-7;1-2;/h2-4,6H2,1H3;1-2H3;1H4.
What are the key properties of ethane;methane;3-methylthiane-3-carbonitrile?
ethane;methane;3-methylthiane-3-carbonitrile has a molecular weight of 187.35 g/mol, XLogP of 3.71, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methane;3-methylthiane-3-carbonitrile is sourced from PubChem (CID 142565790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).