C25H37FN8 — CID 142575241
(1Z)-1-[amino-[1-(2-fluoroethyl)piperidin-4-yl]amino]buta-1,3-dien-2-amine;6-(1,2-dimethyldiazet-3-yl)-N-methylisoquinolin-3-amine (PubChem CID 142575241) has the molecular formula C25H37FN8 and a molecular weight of 468.63 g/mol. Its IUPAC name is (1Z)-1-[amino-[1-(2-fluoroethyl)piperidin-4-yl]amino]buta-1,3-dien-2-amine;6-(1,2-dimethyldiazet-3-yl)-N-methylisoquinolin-3-amine.
| Compound Name | (1Z)-1-[amino-[1-(2-fluoroethyl)piperidin-4-yl]amino]buta-1,3-dien-2-amine;6-(1,2-dimethyldiazet-3-yl)-N-methylisoquinolin-3-amine |
|---|---|
| PubChem CID | 142575241 |
| Molecular Formula | C25H37FN8 |
| Molecular Weight | 468.63 g/mol |
| Exact Mass | 468.31 |
| IUPAC Name | (1Z)-1-[amino-[1-(2-fluoroethyl)piperidin-4-yl]amino]buta-1,3-dien-2-amine;6-(1,2-dimethyldiazet-3-yl)-N-methylisoquinolin-3-amine |
| SMILES | C=C/C(N)=C/N(N)C1CCN(CCF)CC1.CNc1cc2cc(-c3cn(C)n3C)ccc2cn1 |
| InChI | InChI=1S/C14H16N4.C11H21FN4/c1-15-14-7-12-6-10(4-5-11(12)8-16-14)13-9-17(2)18(13)3;1-2-10(13)9-16(14)11-3-6-15(7-4-11)8-5-12/h4-9H,1-3H3,(H,15,16);2,9,11H,1,3-8,13-14H2/b;10-9- |
| InChIKey | NGXYDHCUVULQKC-SVMKZPJVSA-N |
| XLogP | 3.20 |
| TPSA | 93.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.63 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|