C25H30F2N6 — CID 142575321
3-ethenyl-1,1-difluorocyclobutane;N-methyl-6-[6-(piperidin-4-ylamino)pyrazin-2-yl]isoquinolin-3-amine (PubChem CID 142575321) has the molecular formula C25H30F2N6 and a molecular weight of 452.55 g/mol. Its IUPAC name is 3-ethenyl-1,1-difluorocyclobutane;N-methyl-6-[6-(piperidin-4-ylamino)pyrazin-2-yl]isoquinolin-3-amine.
| Compound Name | 3-ethenyl-1,1-difluorocyclobutane;N-methyl-6-[6-(piperidin-4-ylamino)pyrazin-2-yl]isoquinolin-3-amine |
|---|---|
| PubChem CID | 142575321 |
| Molecular Formula | C25H30F2N6 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.25 |
| IUPAC Name | 3-ethenyl-1,1-difluorocyclobutane;N-methyl-6-[6-(piperidin-4-ylamino)pyrazin-2-yl]isoquinolin-3-amine |
| SMILES | C=CC1CC(F)(F)C1.CNc1cc2cc(-c3cncc(NC4CCNCC4)n3)ccc2cn1 |
| InChI | InChI=1S/C19H22N6.C6H8F2/c1-20-18-9-15-8-13(2-3-14(15)10-23-18)17-11-22-12-19(25-17)24-16-4-6-21-7-5-16;1-2-5-3-6(7,8)4-5/h2-3,8-12,16,21H,4-7H2,1H3,(H,20,23)(H,24,25);2,5H,1,3-4H2 |
| InChIKey | GODUUHIQFJMCFY-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 74.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|