C16H11BrIN5O — CID 142576116
1-[(2-bromo-6-iodophenyl)methyl]-4-(furan-2-yl)pyrazolo[3,4-d]pyrimidin-6-amine (PubChem CID 142576116) has the molecular formula C16H11BrIN5O and a molecular weight of 496.11 g/mol. Its IUPAC name is 1-[(2-bromo-6-iodophenyl)methyl]-4-(furan-2-yl)pyrazolo[3,4-d]pyrimidin-6-amine.
| Compound Name | 1-[(2-bromo-6-iodophenyl)methyl]-4-(furan-2-yl)pyrazolo[3,4-d]pyrimidin-6-amine |
|---|---|
| PubChem CID | 142576116 |
| Molecular Formula | C16H11BrIN5O |
| Molecular Weight | 496.11 g/mol |
| Exact Mass | 494.92 |
| IUPAC Name | 1-[(2-bromo-6-iodophenyl)methyl]-4-(furan-2-yl)pyrazolo[3,4-d]pyrimidin-6-amine |
| SMILES | Nc1nc(-c2ccco2)c2cnn(Cc3c(Br)cccc3I)c2n1 |
| InChI | InChI=1S/C16H11BrIN5O/c17-11-3-1-4-12(18)10(11)8-23-15-9(7-20-23)14(21-16(19)22-15)13-5-2-6-24-13/h1-7H,8H2,(H2,19,21,22) |
| InChIKey | NIVCUOLFNLWHBU-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 82.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.11 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|