C19H18FN5O2 — CID 150629509
1-[[3-(3-(18F)fluoropropoxy)phenyl]methyl]-4-(furan-2-yl)pyrazolo[3,4-d]pyrimidin-6-amine (PubChem CID 150629509) has the molecular formula C19H18FN5O2 and a molecular weight of 366.39 g/mol. Its IUPAC name is 1-[[3-(3-(18F)fluoropropoxy)phenyl]methyl]-4-(furan-2-yl)pyrazolo[3,4-d]pyrimidin-6-amine.
| Compound Name | 1-[[3-(3-(18F)fluoropropoxy)phenyl]methyl]-4-(furan-2-yl)pyrazolo[3,4-d]pyrimidin-6-amine |
|---|---|
| PubChem CID | 150629509 |
| Molecular Formula | C19H18FN5O2 |
| Molecular Weight | 366.39 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 1-[[3-(3-(18F)fluoropropoxy)phenyl]methyl]-4-(furan-2-yl)pyrazolo[3,4-d]pyrimidin-6-amine |
| SMILES | Nc1nc(-c2ccco2)c2cnn(Cc3cccc(OCCC[18F])c3)c2n1 |
| InChI | InChI=1S/C19H18FN5O2/c20-7-3-9-26-14-5-1-4-13(10-14)12-25-18-15(11-22-25)17(23-19(21)24-18)16-6-2-8-27-16/h1-2,4-6,8,10-11H,3,7,9,12H2,(H2,21,23,24)/i20-1 |
| InChIKey | IXOTZEJWWHWSRZ-LRFGSCOBSA-N |
| XLogP | 3.46 |
| TPSA | 91.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.39 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|