C21H19N5O3 — CID 169093595
methyl (E)-3-[3-[[6-amino-4-(5-methylfuran-2-yl)pyrazolo[3,4-d]pyrimidin-1-yl]methyl]phenyl]prop-2-enoate (PubChem CID 169093595) has the molecular formula C21H19N5O3 and a molecular weight of 389.42 g/mol. Its IUPAC name is methyl (E)-3-[3-[[6-amino-4-(5-methylfuran-2-yl)pyrazolo[3,4-d]pyrimidin-1-yl]methyl]phenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[3-[[6-amino-4-(5-methylfuran-2-yl)pyrazolo[3,4-d]pyrimidin-1-yl]methyl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 169093595 |
| Molecular Formula | C21H19N5O3 |
| Molecular Weight | 389.42 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | methyl (E)-3-[3-[[6-amino-4-(5-methylfuran-2-yl)pyrazolo[3,4-d]pyrimidin-1-yl]methyl]phenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1cccc(Cn2ncc3c(-c4ccc(C)o4)nc(N)nc32)c1 |
| InChI | InChI=1S/C21H19N5O3/c1-13-6-8-17(29-13)19-16-11-23-26(20(16)25-21(22)24-19)12-15-5-3-4-14(10-15)7-9-18(27)28-2/h3-11H,12H2,1-2H3,(H2,22,24,25)/b9-7+ |
| InChIKey | DWYHEZMRQJNUPD-VQHVLOKHSA-N |
| XLogP | 3.21 |
| TPSA | 109.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.42 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|