C16H15N7O4S — CID 25026124
[3-[[5-amino-7-(5-methylfuran-2-yl)triazolo[4,5-d]pyrimidin-3-yl]methyl]phenyl]sulfamic acid (PubChem CID 25026124) has the molecular formula C16H15N7O4S and a molecular weight of 401.41 g/mol. Its IUPAC name is [3-[[5-amino-7-(5-methylfuran-2-yl)triazolo[4,5-d]pyrimidin-3-yl]methyl]phenyl]sulfamic acid.
| Compound Name | [3-[[5-amino-7-(5-methylfuran-2-yl)triazolo[4,5-d]pyrimidin-3-yl]methyl]phenyl]sulfamic acid |
|---|---|
| PubChem CID | 25026124 |
| Molecular Formula | C16H15N7O4S |
| Molecular Weight | 401.41 g/mol |
| Exact Mass | 401.09 |
| IUPAC Name | [3-[[5-amino-7-(5-methylfuran-2-yl)triazolo[4,5-d]pyrimidin-3-yl]methyl]phenyl]sulfamic acid |
| SMILES | Cc1ccc(-c2nc(N)nc3c2nnn3Cc2cccc(NS(=O)(=O)O)c2)o1 |
| InChI | InChI=1S/C16H15N7O4S/c1-9-5-6-12(27-9)13-14-15(19-16(17)18-13)23(22-20-14)8-10-3-2-4-11(7-10)21-28(24,25)26/h2-7,21H,8H2,1H3,(H2,17,18,19)(H,24,25,26) |
| InChIKey | KQYAXRXERWITSK-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 162.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.41 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|