C10H11F3N2O2 — CID 142577219
2-[pyridin-2-yl(3,3,3-trifluoropropyl)amino]acetic acid (PubChem CID 142577219) has the molecular formula C10H11F3N2O2 and a molecular weight of 248.20 g/mol. Its IUPAC name is 2-[pyridin-2-yl(3,3,3-trifluoropropyl)amino]acetic acid.
| Compound Name | 2-[pyridin-2-yl(3,3,3-trifluoropropyl)amino]acetic acid |
|---|---|
| PubChem CID | 142577219 |
| Molecular Formula | C10H11F3N2O2 |
| Molecular Weight | 248.20 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 2-[pyridin-2-yl(3,3,3-trifluoropropyl)amino]acetic acid |
| SMILES | O=C(O)CN(CCC(F)(F)F)c1ccccn1 |
| InChI | InChI=1S/C10H11F3N2O2/c11-10(12,13)4-6-15(7-9(16)17)8-3-1-2-5-14-8/h1-3,5H,4,6-7H2,(H,16,17) |
| InChIKey | WVNJVGPPSGDXRA-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.20 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |