About methanethiol;2-methanimidoyl-6-phenylphenol
methanethiol;2-methanimidoyl-6-phenylphenol (PubChem CID 142577801) has the molecular formula C14H15NOS
and a molecular weight of 245.35 g/mol. Its IUPAC name is methanethiol;2-methanimidoyl-6-phenylphenol.
Molecular Properties
| Compound Name | methanethiol;2-methanimidoyl-6-phenylphenol |
| PubChem CID | 142577801 |
| Molecular Formula | C14H15NOS |
| Molecular Weight | 245.35 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | methanethiol;2-methanimidoyl-6-phenylphenol |
| SMILES | CS.[H]/N=C/c1cccc(-c2ccccc2)c1O |
| InChI | InChI=1S/C13H11NO.CH4S/c14-9-11-7-4-8-12(13(11)15)10-5-2-1-3-6-10;1-2/h1-9,14-15H;2H,1H3/b14-9+; |
| InChIKey | KBYURBBKROTAHV-KYIGKLDSSA-N |
| XLogP | 3.60 |
| TPSA | 44.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.35 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze methanethiol;2-methanimidoyl-6-phenylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanethiol;2-methanimidoyl-6-phenylphenol?
The IUPAC name of methanethiol;2-methanimidoyl-6-phenylphenol (CID 142577801) is methanethiol;2-methanimidoyl-6-phenylphenol.
What is the SMILES notation for methanethiol;2-methanimidoyl-6-phenylphenol?
The canonical SMILES for methanethiol;2-methanimidoyl-6-phenylphenol is CS.[H]/N=C/c1cccc(-c2ccccc2)c1O.
What is the InChIKey of methanethiol;2-methanimidoyl-6-phenylphenol?
The InChIKey is KBYURBBKROTAHV-KYIGKLDSSA-N. The full InChI is InChI=1S/C13H11NO.CH4S/c14-9-11-7-4-8-12(13(11)15)10-5-2-1-3-6-10;1-2/h1-9,14-15H;2H,1H3/b14-9+;.
What are the key properties of methanethiol;2-methanimidoyl-6-phenylphenol?
methanethiol;2-methanimidoyl-6-phenylphenol has a molecular weight of 245.35 g/mol, XLogP of 3.60, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methanethiol;2-methanimidoyl-6-phenylphenol is sourced from PubChem (CID 142577801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).