C30H28N2O2+2 — CID 23578276
2-[(Z)-[(3Z)-3-[(2-hydroxy-3-phenylphenyl)methylidene]-1,3-diazinane-1,3-diium-1-ylidene]methyl]-6-phenylphenol (PubChem CID 23578276) has the molecular formula C30H28N2O2+2 and a molecular weight of 448.57 g/mol. Its IUPAC name is 2-[(Z)-[(3Z)-3-[(2-hydroxy-3-phenylphenyl)methylidene]-1,3-diazinane-1,3-diium-1-ylidene]methyl]-6-phenylphenol.
| Compound Name | 2-[(Z)-[(3Z)-3-[(2-hydroxy-3-phenylphenyl)methylidene]-1,3-diazinane-1,3-diium-1-ylidene]methyl]-6-phenylphenol |
|---|---|
| PubChem CID | 23578276 |
| Molecular Formula | C30H28N2O2+2 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | 2-[(Z)-[(3Z)-3-[(2-hydroxy-3-phenylphenyl)methylidene]-1,3-diazinane-1,3-diium-1-ylidene]methyl]-6-phenylphenol |
| SMILES | Oc1c(/C=[N+]2/CCC/[N+](=C/c3cccc(-c4ccccc4)c3O)C2)cccc1-c1ccccc1 |
| InChI | InChI=1S/C30H26N2O2/c33-29-25(14-7-16-27(29)23-10-3-1-4-11-23)20-31-18-9-19-32(22-31)21-26-15-8-17-28(30(26)34)24-12-5-2-6-13-24/h1-8,10-17,20-21H,9,18-19,22H2/p+2 |
| InChIKey | BFHUDIXKVILHSI-UHFFFAOYSA-P |
| XLogP | 5.36 |
| TPSA | 46.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|