C9H12F2N2O2 — CID 142578199
5-(1,1-difluoroethyl)-2,6-dimethoxypyridin-3-amine (PubChem CID 142578199) has the molecular formula C9H12F2N2O2 and a molecular weight of 218.20 g/mol. Its IUPAC name is 5-(1,1-difluoroethyl)-2,6-dimethoxypyridin-3-amine.
| Compound Name | 5-(1,1-difluoroethyl)-2,6-dimethoxypyridin-3-amine |
|---|---|
| PubChem CID | 142578199 |
| Molecular Formula | C9H12F2N2O2 |
| Molecular Weight | 218.20 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 5-(1,1-difluoroethyl)-2,6-dimethoxypyridin-3-amine |
| SMILES | COc1nc(OC)c(C(C)(F)F)cc1N |
| InChI | InChI=1S/C9H12F2N2O2/c1-9(10,11)5-4-6(12)8(15-3)13-7(5)14-2/h4H,12H2,1-3H3 |
| InChIKey | IXFGMOZGYVEKPX-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.20 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |