C21H25ClN4 — CID 142579692
N-[(6-chloro-2-piperidin-1-yl-3-pyridinyl)methyl]-2-(1H-indol-3-yl)ethanamine (PubChem CID 142579692) has the molecular formula C21H25ClN4 and a molecular weight of 368.91 g/mol. Its IUPAC name is N-[(6-chloro-2-piperidin-1-yl-3-pyridinyl)methyl]-2-(1H-indol-3-yl)ethanamine.
| Compound Name | N-[(6-chloro-2-piperidin-1-yl-3-pyridinyl)methyl]-2-(1H-indol-3-yl)ethanamine |
|---|---|
| PubChem CID | 142579692 |
| Molecular Formula | C21H25ClN4 |
| Molecular Weight | 368.91 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | N-[(6-chloro-2-piperidin-1-yl-3-pyridinyl)methyl]-2-(1H-indol-3-yl)ethanamine |
| SMILES | Clc1ccc(CNCCc2c[nH]c3ccccc23)c(N2CCCCC2)n1 |
| InChI | InChI=1S/C21H25ClN4/c22-20-9-8-17(21(25-20)26-12-4-1-5-13-26)14-23-11-10-16-15-24-19-7-3-2-6-18(16)19/h2-3,6-9,15,23-24H,1,4-5,10-14H2 |
| InChIKey | XAYDVTIHFQNJEL-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.91 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|