C24H27F2N3O2 — CID 142580511
6-[1-(1-fluorocyclopropanecarbonyl)-3,4-dihydro-2H-quinolin-6-yl]-N-(5-fluoro-2-pyridinyl)hexanamide (PubChem CID 142580511) has the molecular formula C24H27F2N3O2 and a molecular weight of 427.50 g/mol. Its IUPAC name is 6-[1-(1-fluorocyclopropanecarbonyl)-3,4-dihydro-2H-quinolin-6-yl]-N-(5-fluoro-2-pyridinyl)hexanamide.
| Compound Name | 6-[1-(1-fluorocyclopropanecarbonyl)-3,4-dihydro-2H-quinolin-6-yl]-N-(5-fluoro-2-pyridinyl)hexanamide |
|---|---|
| PubChem CID | 142580511 |
| Molecular Formula | C24H27F2N3O2 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | 6-[1-(1-fluorocyclopropanecarbonyl)-3,4-dihydro-2H-quinolin-6-yl]-N-(5-fluoro-2-pyridinyl)hexanamide |
| SMILES | O=C(CCCCCc1ccc2c(c1)CCCN2C(=O)C1(F)CC1)Nc1ccc(F)cn1 |
| InChI | InChI=1S/C24H27F2N3O2/c25-19-9-11-21(27-16-19)28-22(30)7-3-1-2-5-17-8-10-20-18(15-17)6-4-14-29(20)23(31)24(26)12-13-24/h8-11,15-16H,1-7,12-14H2,(H,27,28,30) |
| InChIKey | BPALNZOCFMVBNW-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|