C21H27N3O2 — CID 142580703
ethane;7-methoxy-1-piperidin-1-yl-4-prop-1-ynylisoquinoline-6-carboxamide (PubChem CID 142580703) has the molecular formula C21H27N3O2 and a molecular weight of 353.47 g/mol. Its IUPAC name is ethane;7-methoxy-1-piperidin-1-yl-4-prop-1-ynylisoquinoline-6-carboxamide.
| Compound Name | ethane;7-methoxy-1-piperidin-1-yl-4-prop-1-ynylisoquinoline-6-carboxamide |
|---|---|
| PubChem CID | 142580703 |
| Molecular Formula | C21H27N3O2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | ethane;7-methoxy-1-piperidin-1-yl-4-prop-1-ynylisoquinoline-6-carboxamide |
| SMILES | CC.CC#Cc1cnc(N2CCCCC2)c2cc(OC)c(C(N)=O)cc12 |
| InChI | InChI=1S/C19H21N3O2.C2H6/c1-3-7-13-12-21-19(22-8-5-4-6-9-22)15-11-17(24-2)16(18(20)23)10-14(13)15;1-2/h10-12H,4-6,8-9H2,1-2H3,(H2,20,23);1-2H3 |
| InChIKey | YCFPDGHEEYEDOT-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|