C21H27IN4O4 — CID 175044745
[(3S)-1-(6-carbamoyl-4-iodo-7-methoxyisoquinolin-1-yl)piperidin-3-yl] N-tert-butylcarbamate (PubChem CID 175044745) has the molecular formula C21H27IN4O4 and a molecular weight of 526.38 g/mol. Its IUPAC name is [(3S)-1-(6-carbamoyl-4-iodo-7-methoxyisoquinolin-1-yl)piperidin-3-yl] N-tert-butylcarbamate.
| Compound Name | [(3S)-1-(6-carbamoyl-4-iodo-7-methoxyisoquinolin-1-yl)piperidin-3-yl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 175044745 |
| Molecular Formula | C21H27IN4O4 |
| Molecular Weight | 526.38 g/mol |
| Exact Mass | 526.11 |
| IUPAC Name | [(3S)-1-(6-carbamoyl-4-iodo-7-methoxyisoquinolin-1-yl)piperidin-3-yl] N-tert-butylcarbamate |
| SMILES | COc1cc2c(N3CCC[C@H](OC(=O)NC(C)(C)C)C3)ncc(I)c2cc1C(N)=O |
| InChI | InChI=1S/C21H27IN4O4/c1-21(2,3)25-20(28)30-12-6-5-7-26(11-12)19-14-9-17(29-4)15(18(23)27)8-13(14)16(22)10-24-19/h8-10,12H,5-7,11H2,1-4H3,(H2,23,27)(H,25,28)/t12-/m0/s1 |
| InChIKey | QPIGVFDSPSOKQX-LBPRGKRZSA-N |
| XLogP | 3.44 |
| TPSA | 106.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.38 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|