C15H24N4O2 — CID 174794058
[(3S)-1-(3-amino-4-pyridinyl)piperidin-3-yl] N-tert-butylcarbamate (PubChem CID 174794058) has the molecular formula C15H24N4O2 and a molecular weight of 292.38 g/mol. Its IUPAC name is [(3S)-1-(3-amino-4-pyridinyl)piperidin-3-yl] N-tert-butylcarbamate.
| Compound Name | [(3S)-1-(3-amino-4-pyridinyl)piperidin-3-yl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 174794058 |
| Molecular Formula | C15H24N4O2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | [(3S)-1-(3-amino-4-pyridinyl)piperidin-3-yl] N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)O[C@H]1CCCN(c2ccncc2N)C1 |
| InChI | InChI=1S/C15H24N4O2/c1-15(2,3)18-14(20)21-11-5-4-8-19(10-11)13-6-7-17-9-12(13)16/h6-7,9,11H,4-5,8,10,16H2,1-3H3,(H,18,20)/t11-/m0/s1 |
| InChIKey | JWUSQNLYZCHYDJ-NSHDSACASA-N |
| XLogP | 2.16 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |