C18H29N5O4 — CID 70975415
[1-[2-(ethylamino)-6-methyl-3-nitro-4-pyridinyl]piperidin-3-yl] N-tert-butylcarbamate (PubChem CID 70975415) has the molecular formula C18H29N5O4 and a molecular weight of 379.46 g/mol. Its IUPAC name is [1-[2-(ethylamino)-6-methyl-3-nitro-4-pyridinyl]piperidin-3-yl] N-tert-butylcarbamate.
| Compound Name | [1-[2-(ethylamino)-6-methyl-3-nitro-4-pyridinyl]piperidin-3-yl] N-tert-butylcarbamate |
|---|---|
| PubChem CID | 70975415 |
| Molecular Formula | C18H29N5O4 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.22 |
| IUPAC Name | [1-[2-(ethylamino)-6-methyl-3-nitro-4-pyridinyl]piperidin-3-yl] N-tert-butylcarbamate |
| SMILES | CCNc1nc(C)cc(N2CCCC(OC(=O)NC(C)(C)C)C2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C18H29N5O4/c1-6-19-16-15(23(25)26)14(10-12(2)20-16)22-9-7-8-13(11-22)27-17(24)21-18(3,4)5/h10,13H,6-9,11H2,1-5H3,(H,19,20)(H,21,24) |
| InChIKey | GTHMOVIIYZDDBI-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 109.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|