C12H23N3O5 — CID 67826950
(1-methylpiperidin-3-yl) N-(2-methyl-4-nitrooxybutan-2-yl)carbamate (PubChem CID 67826950) has the molecular formula C12H23N3O5 and a molecular weight of 289.33 g/mol. Its IUPAC name is (1-methylpiperidin-3-yl) N-(2-methyl-4-nitrooxybutan-2-yl)carbamate.
| Compound Name | (1-methylpiperidin-3-yl) N-(2-methyl-4-nitrooxybutan-2-yl)carbamate |
|---|---|
| PubChem CID | 67826950 |
| Molecular Formula | C12H23N3O5 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | (1-methylpiperidin-3-yl) N-(2-methyl-4-nitrooxybutan-2-yl)carbamate |
| SMILES | CN1CCCC(OC(=O)NC(C)(C)CCO[N+](=O)[O-])C1 |
| InChI | InChI=1S/C12H23N3O5/c1-12(2,6-8-19-15(17)18)13-11(16)20-10-5-4-7-14(3)9-10/h10H,4-9H2,1-3H3,(H,13,16) |
| InChIKey | VPNWZSDIHLFJRG-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|