C11H21NO — CID 142582131
2,5-di(propan-2-yl)-1,3-oxazole;ethane (PubChem CID 142582131) has the molecular formula C11H21NO and a molecular weight of 183.29 g/mol. Its IUPAC name is 2,5-di(propan-2-yl)-1,3-oxazole;ethane.
| Compound Name | 2,5-di(propan-2-yl)-1,3-oxazole;ethane |
|---|---|
| PubChem CID | 142582131 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | 2,5-di(propan-2-yl)-1,3-oxazole;ethane |
| SMILES | CC.CC(C)c1cnc(C(C)C)o1 |
| InChI | InChI=1S/C9H15NO.C2H6/c1-6(2)8-5-10-9(11-8)7(3)4;1-2/h5-7H,1-4H3;1-2H3 |
| InChIKey | CMPCBXNMOZZXNV-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |