C23H32Cl2N4O2 — CID 142582287
tert-butyl 4-[(1E,3Z)-4-amino-3-(N-amino-2,6-dichloroanilino)-4-cyclopropylbuta-1,3-dienyl]piperidine-1-carboxylate (PubChem CID 142582287) has the molecular formula C23H32Cl2N4O2 and a molecular weight of 467.44 g/mol. Its IUPAC name is tert-butyl 4-[(1E,3Z)-4-amino-3-(N-amino-2,6-dichloroanilino)-4-cyclopropylbuta-1,3-dienyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[(1E,3Z)-4-amino-3-(N-amino-2,6-dichloroanilino)-4-cyclopropylbuta-1,3-dienyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 142582287 |
| Molecular Formula | C23H32Cl2N4O2 |
| Molecular Weight | 467.44 g/mol |
| Exact Mass | 466.19 |
| IUPAC Name | tert-butyl 4-[(1E,3Z)-4-amino-3-(N-amino-2,6-dichloroanilino)-4-cyclopropylbuta-1,3-dienyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(/C=C/C(=C(/N)C2CC2)N(N)c2c(Cl)cccc2Cl)CC1 |
| InChI | InChI=1S/C23H32Cl2N4O2/c1-23(2,3)31-22(30)28-13-11-15(12-14-28)7-10-19(20(26)16-8-9-16)29(27)21-17(24)5-4-6-18(21)25/h4-7,10,15-16H,8-9,11-14,26-27H2,1-3H3/b10-7+,20-19- |
| InChIKey | SYIDIZJKKRKICF-NBDCDUIASA-N |
| XLogP | 5.46 |
| TPSA | 84.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.44 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|