C14H20N2O2 — CID 142582625
tert-butyl (4Z)-4-(cyanomethylidene)-1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxylate (PubChem CID 142582625) has the molecular formula C14H20N2O2 and a molecular weight of 248.33 g/mol. Its IUPAC name is tert-butyl (4Z)-4-(cyanomethylidene)-1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxylate.
| Compound Name | tert-butyl (4Z)-4-(cyanomethylidene)-1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 142582625 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | tert-butyl (4Z)-4-(cyanomethylidene)-1,3,3a,5,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2CC/C(=C/C#N)C2C1 |
| InChI | InChI=1S/C14H20N2O2/c1-14(2,3)18-13(17)16-8-11-5-4-10(6-7-15)12(11)9-16/h6,11-12H,4-5,8-9H2,1-3H3/b10-6- |
| InChIKey | NKRNJYWQQYKWAS-POHAHGRESA-N |
| XLogP | 2.71 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|