About acetonitrile;tert-butyl 3-(cyanomethylidene)azetidine-1-carboxylate
acetonitrile;tert-butyl 3-(cyanomethylidene)azetidine-1-carboxylate (PubChem CID 157481942) has the molecular formula C12H17N3O2
and a molecular weight of 235.29 g/mol. Its IUPAC name is acetonitrile;tert-butyl 3-(cyanomethylidene)azetidine-1-carboxylate.
Molecular Properties
| Compound Name | acetonitrile;tert-butyl 3-(cyanomethylidene)azetidine-1-carboxylate |
| PubChem CID | 157481942 |
| Molecular Formula | C12H17N3O2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | acetonitrile;tert-butyl 3-(cyanomethylidene)azetidine-1-carboxylate |
| SMILES | CC#N.CC(C)(C)OC(=O)N1CC(=CC#N)C1 |
| InChI | InChI=1S/C10H14N2O2.C2H3N/c1-10(2,3)14-9(13)12-6-8(7-12)4-5-11;1-2-3/h4H,6-7H2,1-3H3;1H3 |
| InChIKey | BWGKQJAJRATGRW-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 77.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze acetonitrile;tert-butyl 3-(cyanomethylidene)azetidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetonitrile;tert-butyl 3-(cyanomethylidene)azetidine-1-carboxylate?
The IUPAC name of acetonitrile;tert-butyl 3-(cyanomethylidene)azetidine-1-carboxylate (CID 157481942) is acetonitrile;tert-butyl 3-(cyanomethylidene)azetidine-1-carboxylate.
What is the SMILES notation for acetonitrile;tert-butyl 3-(cyanomethylidene)azetidine-1-carboxylate?
The canonical SMILES for acetonitrile;tert-butyl 3-(cyanomethylidene)azetidine-1-carboxylate is CC#N.CC(C)(C)OC(=O)N1CC(=CC#N)C1.
What is the InChIKey of acetonitrile;tert-butyl 3-(cyanomethylidene)azetidine-1-carboxylate?
The InChIKey is BWGKQJAJRATGRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O2.C2H3N/c1-10(2,3)14-9(13)12-6-8(7-12)4-5-11;1-2-3/h4H,6-7H2,1-3H3;1H3.
What are the key properties of acetonitrile;tert-butyl 3-(cyanomethylidene)azetidine-1-carboxylate?
acetonitrile;tert-butyl 3-(cyanomethylidene)azetidine-1-carboxylate has a molecular weight of 235.29 g/mol, XLogP of 2.22, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetonitrile;tert-butyl 3-(cyanomethylidene)azetidine-1-carboxylate is sourced from PubChem (CID 157481942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).