C23H23ClN6O4 — CID 142582897
2-amino-N-pyrrolidin-3-ylpyrimidine-4-carboxamide;4-(5-chloro-2-hydroxybenzoyl)benzamide (PubChem CID 142582897) has the molecular formula C23H23ClN6O4 and a molecular weight of 482.93 g/mol. Its IUPAC name is 2-amino-N-pyrrolidin-3-ylpyrimidine-4-carboxamide;4-(5-chloro-2-hydroxybenzoyl)benzamide.
| Compound Name | 2-amino-N-pyrrolidin-3-ylpyrimidine-4-carboxamide;4-(5-chloro-2-hydroxybenzoyl)benzamide |
|---|---|
| PubChem CID | 142582897 |
| Molecular Formula | C23H23ClN6O4 |
| Molecular Weight | 482.93 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | 2-amino-N-pyrrolidin-3-ylpyrimidine-4-carboxamide;4-(5-chloro-2-hydroxybenzoyl)benzamide |
| SMILES | NC(=O)c1ccc(C(=O)c2cc(Cl)ccc2O)cc1.Nc1nccc(C(=O)NC2CCNC2)n1 |
| InChI | InChI=1S/C14H10ClNO3.C9H13N5O/c15-10-5-6-12(17)11(7-10)13(18)8-1-3-9(4-2-8)14(16)19;10-9-12-4-2-7(14-9)8(15)13-6-1-3-11-5-6/h1-7,17H,(H2,16,19);2,4,6,11H,1,3,5H2,(H,13,15)(H2,10,12,14) |
| InChIKey | GUNAQHOWJIKUDC-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 173.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.93 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |