C15H14FNO4 — CID 142582976
4-[(2-fluoro-6-hydroxy-3-methoxyphenyl)-hydroxymethyl]benzamide (PubChem CID 142582976) has the molecular formula C15H14FNO4 and a molecular weight of 291.28 g/mol. Its IUPAC name is 4-[(2-fluoro-6-hydroxy-3-methoxyphenyl)-hydroxymethyl]benzamide.
| Compound Name | 4-[(2-fluoro-6-hydroxy-3-methoxyphenyl)-hydroxymethyl]benzamide |
|---|---|
| PubChem CID | 142582976 |
| Molecular Formula | C15H14FNO4 |
| Molecular Weight | 291.28 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 4-[(2-fluoro-6-hydroxy-3-methoxyphenyl)-hydroxymethyl]benzamide |
| SMILES | COc1ccc(O)c(C(O)c2ccc(C(N)=O)cc2)c1F |
| InChI | InChI=1S/C15H14FNO4/c1-21-11-7-6-10(18)12(13(11)16)14(19)8-2-4-9(5-3-8)15(17)20/h2-7,14,18-19H,1H3,(H2,17,20) |
| InChIKey | LCWDHNXVPDOKHG-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.28 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |