C12H22N2O2 — CID 142585991
4-[formyl(methyl)amino]-N,N-dimethylcycloheptane-1-carboxamide (PubChem CID 142585991) has the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. Its IUPAC name is 4-[formyl(methyl)amino]-N,N-dimethylcycloheptane-1-carboxamide.
| Compound Name | 4-[formyl(methyl)amino]-N,N-dimethylcycloheptane-1-carboxamide |
|---|---|
| PubChem CID | 142585991 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | 4-[formyl(methyl)amino]-N,N-dimethylcycloheptane-1-carboxamide |
| SMILES | CN(C)C(=O)C1CCCC(N(C)C=O)CC1 |
| InChI | InChI=1S/C12H22N2O2/c1-13(2)12(16)10-5-4-6-11(8-7-10)14(3)9-15/h9-11H,4-8H2,1-3H3 |
| InChIKey | WCBBBCGKLZUMBQ-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|