C9H13N3O — CID 142586839
N'-(1-acetyl-4-ethenyl-2,5-dihydropyrrol-3-yl)methanimidamide (PubChem CID 142586839) has the molecular formula C9H13N3O and a molecular weight of 179.22 g/mol. Its IUPAC name is N'-(1-acetyl-4-ethenyl-2,5-dihydropyrrol-3-yl)methanimidamide.
| Compound Name | N'-(1-acetyl-4-ethenyl-2,5-dihydropyrrol-3-yl)methanimidamide |
|---|---|
| PubChem CID | 142586839 |
| Molecular Formula | C9H13N3O |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | N'-(1-acetyl-4-ethenyl-2,5-dihydropyrrol-3-yl)methanimidamide |
| SMILES | C=CC1=C(/N=C/N)CN(C(C)=O)C1 |
| InChI | InChI=1S/C9H13N3O/c1-3-8-4-12(7(2)13)5-9(8)11-6-10/h3,6H,1,4-5H2,2H3,(H2,10,11) |
| InChIKey | BZWUUTRQCHBXEU-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|